About (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide
(2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide (PubChem CID 95841028) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide.
Molecular Properties
| Compound Name | (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide |
| PubChem CID | 95841028 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide |
| SMILES | Cc1ccc(N2CCO[C@](C)(C(=O)N(C)C)C2)nn1 |
| InChI | InChI=1S/C13H20N4O2/c1-10-5-6-11(15-14-10)17-7-8-19-13(2,9-17)12(18)16(3)4/h5-6H,7-9H2,1-4H3/t13-/m0/s1 |
| InChIKey | OLPSTCYCRGKMOW-ZDUSSCGKSA-N |
| XLogP | 0.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide?
The IUPAC name of (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide (CID 95841028) is (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide.
What is the SMILES notation for (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide?
The canonical SMILES for (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide is Cc1ccc(N2CCO[C@](C)(C(=O)N(C)C)C2)nn1.
What is the InChIKey of (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide?
The InChIKey is OLPSTCYCRGKMOW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-10-5-6-11(15-14-10)17-7-8-19-13(2,9-17)12(18)16(3)4/h5-6H,7-9H2,1-4H3/t13-/m0/s1.
What are the key properties of (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide?
(2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide has a molecular weight of 264.33 g/mol, XLogP of 0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N,N,2-trimethyl-4-(6-methylpyridazin-3-yl)morpholine-2-carboxamide is sourced from PubChem (CID 95841028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).