C24H33N5O3 — CID 95858004
11-[[(1S)-cyclohex-3-en-1-yl]methyl]-5-[1-(2-methoxyacetyl)piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 95858004) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is 11-[[(1S)-cyclohex-3-en-1-yl]methyl]-5-[1-(2-methoxyacetyl)piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-[[(1S)-cyclohex-3-en-1-yl]methyl]-5-[1-(2-methoxyacetyl)piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 95858004 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 11-[[(1S)-cyclohex-3-en-1-yl]methyl]-5-[1-(2-methoxyacetyl)piperidin-4-yl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | COCC(=O)N1CCC(c2cc3nc4c(c(=O)n3[nH]2)CN(C[C@@H]2CC=CCC2)CC4)CC1 |
| InChI | InChI=1S/C24H33N5O3/c1-32-16-23(30)28-11-7-18(8-12-28)21-13-22-25-20-9-10-27(14-17-5-3-2-4-6-17)15-19(20)24(31)29(22)26-21/h2-3,13,17-18,26H,4-12,14-16H2,1H3/t17-/m1/s1 |
| InChIKey | PPVUWAMMRHLMBG-QGZVFWFLSA-N |
| XLogP | 2.09 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|