About [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate
[(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate (PubChem CID 95858731) has the molecular formula C19H37ClO3
and a molecular weight of 348.96 g/mol. Its IUPAC name is [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate.
Molecular Properties
| Compound Name | [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate |
| PubChem CID | 95858731 |
| Molecular Formula | C19H37ClO3 |
| Molecular Weight | 348.96 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)O[C@H](CO)CCl |
| InChI | InChI=1S/C19H37ClO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-18(16-20)17-21/h18,21H,2-17H2,1H3/t18-/m0/s1 |
| InChIKey | NURTYQLWOUBFLF-SFHVURJKSA-N |
| XLogP | 5.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.96 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate?
The IUPAC name of [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate (CID 95858731) is [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate.
What is the SMILES notation for [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate?
The canonical SMILES for [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate is CCCCCCCCCCCCCCCC(=O)O[C@H](CO)CCl.
What is the InChIKey of [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate?
The InChIKey is NURTYQLWOUBFLF-SFHVURJKSA-N. The full InChI is InChI=1S/C19H37ClO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(22)23-18(16-20)17-21/h18,21H,2-17H2,1H3/t18-/m0/s1.
What are the key properties of [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate?
[(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate has a molecular weight of 348.96 g/mol, XLogP of 5.61, 17 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-chloro-3-hydroxypropan-2-yl] hexadecanoate is sourced from PubChem (CID 95858731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).