C16H21N3O4 — CID 95858808
cis-(1S,3R)-2,2-dimethyl-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 95858808) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is cis-(1S,3R)-2,2-dimethyl-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-2,2-dimethyl-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 95858808 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | cis-(1S,3R)-2,2-dimethyl-3-[2-(phenylcarbamoylamino)ethylcarbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1(C)[C@H](C(=O)NCCNC(=O)Nc2ccccc2)[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H21N3O4/c1-16(2)11(12(16)14(21)22)13(20)17-8-9-18-15(23)19-10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3,(H,17,20)(H,21,22)(H2,18,19,23)/t11-,12+/m0/s1 |
| InChIKey | UORPATOUVFRQBT-NWDGAFQWSA-N |
| XLogP | 1.28 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|