C22H21N3O2 — CID 95868995
(4R)-5-(1,3-benzodioxol-5-ylmethyl)-4-(3-ethenylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 95868995) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is (4R)-5-(1,3-benzodioxol-5-ylmethyl)-4-(3-ethenylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | (4R)-5-(1,3-benzodioxol-5-ylmethyl)-4-(3-ethenylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 95868995 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (4R)-5-(1,3-benzodioxol-5-ylmethyl)-4-(3-ethenylphenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | C=Cc1cccc([C@@H]2c3nc[nH]c3CCN2Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C22H21N3O2/c1-2-15-4-3-5-17(10-15)22-21-18(23-13-24-21)8-9-25(22)12-16-6-7-19-20(11-16)27-14-26-19/h2-7,10-11,13,22H,1,8-9,12,14H2,(H,23,24)/t22-/m1/s1 |
| InChIKey | IRWBYYOTNBAISM-JOCHJYFZSA-N |
| XLogP | 3.93 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |