C17H17Cl2N5 — CID 95869943
(4R)-4-(2,3-dichloro-4-methylphenyl)-5-(1H-imidazol-2-ylmethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 95869943) has the molecular formula C17H17Cl2N5 and a molecular weight of 362.26 g/mol. Its IUPAC name is (4R)-4-(2,3-dichloro-4-methylphenyl)-5-(1H-imidazol-2-ylmethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | (4R)-4-(2,3-dichloro-4-methylphenyl)-5-(1H-imidazol-2-ylmethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 95869943 |
| Molecular Formula | C17H17Cl2N5 |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (4R)-4-(2,3-dichloro-4-methylphenyl)-5-(1H-imidazol-2-ylmethyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cc1ccc([C@@H]2c3nc[nH]c3CCN2Cc2ncc[nH]2)c(Cl)c1Cl |
| InChI | InChI=1S/C17H17Cl2N5/c1-10-2-3-11(15(19)14(10)18)17-16-12(22-9-23-16)4-7-24(17)8-13-20-5-6-21-13/h2-3,5-6,9,17H,4,7-8H2,1H3,(H,20,21)(H,22,23)/t17-/m1/s1 |
| InChIKey | OSDGAGCKIUDHKV-QGZVFWFLSA-N |
| XLogP | 3.90 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |