C18H18ClF2N5 — CID 95223626
(4S)-5-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(2,6-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 95223626) has the molecular formula C18H18ClF2N5 and a molecular weight of 377.83 g/mol. Its IUPAC name is (4S)-5-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(2,6-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | (4S)-5-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(2,6-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 95223626 |
| Molecular Formula | C18H18ClF2N5 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (4S)-5-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-4-(2,6-difluorophenyl)-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCc2[nH]cnc2[C@@H]1c1c(F)cccc1F |
| InChI | InChI=1S/C18H18ClF2N5/c1-10-11(18(19)25(2)24-10)8-26-7-6-14-16(23-9-22-14)17(26)15-12(20)4-3-5-13(15)21/h3-5,9,17H,6-8H2,1-2H3,(H,22,23)/t17-/m0/s1 |
| InChIKey | HOZQYEVRGRCRCJ-KRWDZBQOSA-N |
| XLogP | 3.53 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |