C20H25N5S — CID 95889407
(4S)-4-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)-5-[(3-methylthiophen-2-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 95889407) has the molecular formula C20H25N5S and a molecular weight of 367.52 g/mol. Its IUPAC name is (4S)-4-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)-5-[(3-methylthiophen-2-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | (4S)-4-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)-5-[(3-methylthiophen-2-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 95889407 |
| Molecular Formula | C20H25N5S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (4S)-4-(3,5-dimethyl-1-prop-2-enylpyrazol-4-yl)-5-[(3-methylthiophen-2-yl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | C=CCn1nc(C)c([C@H]2c3nc[nH]c3CCN2Cc2sccc2C)c1C |
| InChI | InChI=1S/C20H25N5S/c1-5-8-25-15(4)18(14(3)23-25)20-19-16(21-12-22-19)6-9-24(20)11-17-13(2)7-10-26-17/h5,7,10,12,20H,1,6,8-9,11H2,2-4H3,(H,21,22)/t20-/m0/s1 |
| InChIKey | JYZOHPZXUGYAFZ-FQEVSTJZSA-N |
| XLogP | 3.93 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|