About N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine
N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 95870096) has the molecular formula C16H16F2N4
and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 95870096 |
| Molecular Formula | C16H16F2N4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1cc(N[C@H](C)c2ccc(F)cc2F)n2nccc2n1 |
| InChI | InChI=1S/C16H16F2N4/c1-3-12-9-16(22-15(21-12)6-7-19-22)20-10(2)13-5-4-11(17)8-14(13)18/h4-10,20H,3H2,1-2H3/t10-/m1/s1 |
| InChIKey | VWCYYPWZFMIGTE-SNVBAGLBSA-N |
| XLogP | 3.74 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine (CID 95870096) is N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine is CCc1cc(N[C@H](C)c2ccc(F)cc2F)n2nccc2n1.
What is the InChIKey of N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is VWCYYPWZFMIGTE-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H16F2N4/c1-3-12-9-16(22-15(21-12)6-7-19-22)20-10(2)13-5-4-11(17)8-14(13)18/h4-10,20H,3H2,1-2H3/t10-/m1/s1.
What are the key properties of N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine?
N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 302.33 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R)-1-(2,4-difluorophenyl)ethyl]-5-ethylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 95870096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).