C20H24FNO3 — CID 95870855
N-[(1R)-1-(3-fluoro-4-hydroxyphenyl)ethyl]-4-(3-hydroxy-3-methylbutyl)benzamide (PubChem CID 95870855) has the molecular formula C20H24FNO3 and a molecular weight of 345.41 g/mol. Its IUPAC name is N-[(1R)-1-(3-fluoro-4-hydroxyphenyl)ethyl]-4-(3-hydroxy-3-methylbutyl)benzamide.
| Compound Name | N-[(1R)-1-(3-fluoro-4-hydroxyphenyl)ethyl]-4-(3-hydroxy-3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 95870855 |
| Molecular Formula | C20H24FNO3 |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[(1R)-1-(3-fluoro-4-hydroxyphenyl)ethyl]-4-(3-hydroxy-3-methylbutyl)benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(CCC(C)(C)O)cc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C20H24FNO3/c1-13(16-8-9-18(23)17(21)12-16)22-19(24)15-6-4-14(5-7-15)10-11-20(2,3)25/h4-9,12-13,23,25H,10-11H2,1-3H3,(H,22,24)/t13-/m1/s1 |
| InChIKey | XUGLXRZXFZCIAE-CYBMUJFWSA-N |
| XLogP | 3.73 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |