C18H15FN4O2 — CID 74249303
N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]-2-pyridin-4-ylpyrimidine-5-carboxamide (PubChem CID 74249303) has the molecular formula C18H15FN4O2 and a molecular weight of 338.34 g/mol. Its IUPAC name is N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]-2-pyridin-4-ylpyrimidine-5-carboxamide.
| Compound Name | N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]-2-pyridin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 74249303 |
| Molecular Formula | C18H15FN4O2 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[1-(3-fluoro-4-hydroxyphenyl)ethyl]-2-pyridin-4-ylpyrimidine-5-carboxamide |
| SMILES | CC(NC(=O)c1cnc(-c2ccncc2)nc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C18H15FN4O2/c1-11(13-2-3-16(24)15(19)8-13)23-18(25)14-9-21-17(22-10-14)12-4-6-20-7-5-12/h2-11,24H,1H3,(H,23,25) |
| InChIKey | JORTUMGOBGEDQN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |