C24H19FN4O — CID 53143559
N-[1-(4-fluorophenyl)ethyl]-2-phenyl-4-pyridin-4-ylpyrimidine-5-carboxamide (PubChem CID 53143559) has the molecular formula C24H19FN4O and a molecular weight of 398.44 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-2-phenyl-4-pyridin-4-ylpyrimidine-5-carboxamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-2-phenyl-4-pyridin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53143559 |
| Molecular Formula | C24H19FN4O |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-2-phenyl-4-pyridin-4-ylpyrimidine-5-carboxamide |
| SMILES | CC(NC(=O)c1cnc(-c2ccccc2)nc1-c1ccncc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H19FN4O/c1-16(17-7-9-20(25)10-8-17)28-24(30)21-15-27-23(19-5-3-2-4-6-19)29-22(21)18-11-13-26-14-12-18/h2-16H,1H3,(H,28,30) |
| InChIKey | KZEHKZLWNKNOHB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |