C24H20N4OS — CID 53143621
2-(4-methylphenyl)-N-(2-methylsulfanylphenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide (PubChem CID 53143621) has the molecular formula C24H20N4OS and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-(2-methylsulfanylphenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide.
| Compound Name | 2-(4-methylphenyl)-N-(2-methylsulfanylphenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53143621 |
| Molecular Formula | C24H20N4OS |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-(4-methylphenyl)-N-(2-methylsulfanylphenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide |
| SMILES | CSc1ccccc1NC(=O)c1cnc(-c2ccc(C)cc2)nc1-c1ccncc1 |
| InChI | InChI=1S/C24H20N4OS/c1-16-7-9-18(10-8-16)23-26-15-19(22(28-23)17-11-13-25-14-12-17)24(29)27-20-5-3-4-6-21(20)30-2/h3-15H,1-2H3,(H,27,29) |
| InChIKey | QQVTVDIVSUZRLZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |