C23H16F2N4O — CID 53143686
N-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide (PubChem CID 53143686) has the molecular formula C23H16F2N4O and a molecular weight of 402.40 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 53143686 |
| Molecular Formula | C23H16F2N4O |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-2-(4-fluorophenyl)-4-pyridin-4-ylpyrimidine-5-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnc(-c3ccc(F)cc3)nc2-c2ccncc2)ccc1F |
| InChI | InChI=1S/C23H16F2N4O/c1-14-12-18(6-7-20(14)25)28-23(30)19-13-27-22(16-2-4-17(24)5-3-16)29-21(19)15-8-10-26-11-9-15/h2-13H,1H3,(H,28,30) |
| InChIKey | TTWDJFUCZKILDI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |