C18H16N4OS — CID 143426015
N-(4-methylphenyl)-4-methylsulfanyl-2-pyridin-4-ylpyrimidine-5-carboxamide (PubChem CID 143426015) has the molecular formula C18H16N4OS and a molecular weight of 336.42 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-methylsulfanyl-2-pyridin-4-ylpyrimidine-5-carboxamide.
| Compound Name | N-(4-methylphenyl)-4-methylsulfanyl-2-pyridin-4-ylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 143426015 |
| Molecular Formula | C18H16N4OS |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(4-methylphenyl)-4-methylsulfanyl-2-pyridin-4-ylpyrimidine-5-carboxamide |
| SMILES | CSc1nc(-c2ccncc2)ncc1C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C18H16N4OS/c1-12-3-5-14(6-4-12)21-17(23)15-11-20-16(22-18(15)24-2)13-7-9-19-10-8-13/h3-11H,1-2H3,(H,21,23) |
| InChIKey | NGLKEWGSPIQVAO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |