C19H30FN5O2 — CID 95872548
2-[(2R)-1-cyclopentyl-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperazin-2-yl]ethanol (PubChem CID 95872548) has the molecular formula C19H30FN5O2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 2-[(2R)-1-cyclopentyl-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-cyclopentyl-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 95872548 |
| Molecular Formula | C19H30FN5O2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 2-[(2R)-1-cyclopentyl-4-(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)piperazin-2-yl]ethanol |
| SMILES | OCC[C@@H]1CN(c2ncc(F)c(N3CCOCC3)n2)CCN1C1CCCC1 |
| InChI | InChI=1S/C19H30FN5O2/c20-17-13-21-19(22-18(17)23-8-11-27-12-9-23)24-6-7-25(15-3-1-2-4-15)16(14-24)5-10-26/h13,15-16,26H,1-12,14H2/t16-/m1/s1 |
| InChIKey | ZLASPHLTIFQSLB-MRXNPFEDSA-N |
| XLogP | 1.27 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |