C15H16F3N5 — CID 95872985
N-[(1R)-2,2,2-trifluoro-1-pyridin-2-ylethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine (PubChem CID 95872985) has the molecular formula C15H16F3N5 and a molecular weight of 323.32 g/mol. Its IUPAC name is N-[(1R)-2,2,2-trifluoro-1-pyridin-2-ylethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine.
| Compound Name | N-[(1R)-2,2,2-trifluoro-1-pyridin-2-ylethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 95872985 |
| Molecular Formula | C15H16F3N5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-[(1R)-2,2,2-trifluoro-1-pyridin-2-ylethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepin-4-amine |
| SMILES | FC(F)(F)[C@H](Nc1ncnc2c1CCNCC2)c1ccccn1 |
| InChI | InChI=1S/C15H16F3N5/c16-15(17,18)13(12-3-1-2-6-20-12)23-14-10-4-7-19-8-5-11(10)21-9-22-14/h1-3,6,9,13,19H,4-5,7-8H2,(H,21,22,23)/t13-/m1/s1 |
| InChIKey | SUCVEISXSVCFNB-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |