C17H24N2O3S2 — CID 95880591
2-[(3S)-4-(5-ethylthiophene-3-carbonyl)morpholin-3-yl]-1-thiomorpholin-4-ylethanone (PubChem CID 95880591) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-[(3S)-4-(5-ethylthiophene-3-carbonyl)morpholin-3-yl]-1-thiomorpholin-4-ylethanone.
| Compound Name | 2-[(3S)-4-(5-ethylthiophene-3-carbonyl)morpholin-3-yl]-1-thiomorpholin-4-ylethanone |
|---|---|
| PubChem CID | 95880591 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[(3S)-4-(5-ethylthiophene-3-carbonyl)morpholin-3-yl]-1-thiomorpholin-4-ylethanone |
| SMILES | CCc1cc(C(=O)N2CCOC[C@@H]2CC(=O)N2CCSCC2)cs1 |
| InChI | InChI=1S/C17H24N2O3S2/c1-2-15-9-13(12-24-15)17(21)19-3-6-22-11-14(19)10-16(20)18-4-7-23-8-5-18/h9,12,14H,2-8,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | VBHLVMIEAXFDEQ-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |