C15H15F2N3O3 — CID 95883032
(4R)-5-[(2,3-difluoro-6-methoxyphenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylic acid (PubChem CID 95883032) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is (4R)-5-[(2,3-difluoro-6-methoxyphenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylic acid.
| Compound Name | (4R)-5-[(2,3-difluoro-6-methoxyphenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 95883032 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (4R)-5-[(2,3-difluoro-6-methoxyphenyl)methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine-4-carboxylic acid |
| SMILES | COc1ccc(F)c(F)c1CN1CCc2[nH]cnc2[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H15F2N3O3/c1-23-11-3-2-9(16)12(17)8(11)6-20-5-4-10-13(19-7-18-10)14(20)15(21)22/h2-3,7,14H,4-6H2,1H3,(H,18,19)(H,21,22)/t14-/m1/s1 |
| InChIKey | OMMDSGXGFFFPRS-CQSZACIVSA-N |
| XLogP | 1.88 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |