C18H22F2N2O3 — CID 56881885
2-[4-[(2,3-difluoro-6-methoxyphenyl)methyl]morpholin-3-yl]-1-(2,5-dihydropyrrol-1-yl)ethanone (PubChem CID 56881885) has the molecular formula C18H22F2N2O3 and a molecular weight of 352.38 g/mol. Its IUPAC name is 2-[4-[(2,3-difluoro-6-methoxyphenyl)methyl]morpholin-3-yl]-1-(2,5-dihydropyrrol-1-yl)ethanone.
| Compound Name | 2-[4-[(2,3-difluoro-6-methoxyphenyl)methyl]morpholin-3-yl]-1-(2,5-dihydropyrrol-1-yl)ethanone |
|---|---|
| PubChem CID | 56881885 |
| Molecular Formula | C18H22F2N2O3 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[4-[(2,3-difluoro-6-methoxyphenyl)methyl]morpholin-3-yl]-1-(2,5-dihydropyrrol-1-yl)ethanone |
| SMILES | COc1ccc(F)c(F)c1CN1CCOCC1CC(=O)N1CC=CC1 |
| InChI | InChI=1S/C18H22F2N2O3/c1-24-16-5-4-15(19)18(20)14(16)11-22-8-9-25-12-13(22)10-17(23)21-6-2-3-7-21/h2-5,13H,6-12H2,1H3 |
| InChIKey | KMUKPSDMZYLHFJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|