C19H32N2O2 — CID 95889308
(3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropoxy)phenyl]methyl]piperidin-3-ol (PubChem CID 95889308) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropoxy)phenyl]methyl]piperidin-3-ol.
| Compound Name | (3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropoxy)phenyl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 95889308 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | (3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropoxy)phenyl]methyl]piperidin-3-ol |
| SMILES | CC(C)COc1cccc(CN2CCC[C@](O)(CN(C)C)C2)c1 |
| InChI | InChI=1S/C19H32N2O2/c1-16(2)13-23-18-8-5-7-17(11-18)12-21-10-6-9-19(22,15-21)14-20(3)4/h5,7-8,11,16,22H,6,9-10,12-15H2,1-4H3/t19-/m0/s1 |
| InChIKey | WIEVBCSCBFUNAN-IBGZPJMESA-N |
| XLogP | 2.61 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |