C16H30N4O — CID 95721451
(3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]piperidin-3-ol (PubChem CID 95721451) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is (3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]piperidin-3-ol.
| Compound Name | (3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 95721451 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (3S)-3-[(dimethylamino)methyl]-1-[[3-(2-methylpropyl)imidazol-4-yl]methyl]piperidin-3-ol |
| SMILES | CC(C)Cn1cncc1CN1CCC[C@](O)(CN(C)C)C1 |
| InChI | InChI=1S/C16H30N4O/c1-14(2)9-20-13-17-8-15(20)10-19-7-5-6-16(21,12-19)11-18(3)4/h8,13-14,21H,5-7,9-12H2,1-4H3/t16-/m0/s1 |
| InChIKey | XQFGVEHKSRKDIX-INIZCTEOSA-N |
| XLogP | 1.43 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |