C14H28N6O — CID 126828764
1-[(1-tert-butyltetrazol-5-yl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol (PubChem CID 126828764) has the molecular formula C14H28N6O and a molecular weight of 296.42 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 126828764 |
| Molecular Formula | C14H28N6O |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.23 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)methyl]-3-[(dimethylamino)methyl]piperidin-3-ol |
| SMILES | CN(C)CC1(O)CCCN(Cc2nnnn2C(C)(C)C)C1 |
| InChI | InChI=1S/C14H28N6O/c1-13(2,3)20-12(15-16-17-20)9-19-8-6-7-14(21,11-19)10-18(4)5/h21H,6-11H2,1-5H3 |
| InChIKey | MEHDVAZJYMRHHD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |