C18H22N8 — CID 95896551
4-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 95896551) has the molecular formula C18H22N8 and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 95896551 |
| Molecular Formula | C18H22N8 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 4-N-[(1R)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | C[C@@H](Nc1nc(N)nc2c1CCNCC2)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H22N8/c1-12(13-2-4-14(5-3-13)26-11-21-10-22-26)23-17-15-6-8-20-9-7-16(15)24-18(19)25-17/h2-5,10-12,20H,6-9H2,1H3,(H3,19,23,24,25)/t12-/m1/s1 |
| InChIKey | ZRMKAZUXFKKKDA-GFCCVEGCSA-N |
| XLogP | 1.50 |
| TPSA | 106.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |