C16H17F2N5O — CID 95902916
(2R)-N-(3-cyanophenyl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]propanamide (PubChem CID 95902916) has the molecular formula C16H17F2N5O and a molecular weight of 333.34 g/mol. Its IUPAC name is (2R)-N-(3-cyanophenyl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]propanamide.
| Compound Name | (2R)-N-(3-cyanophenyl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]propanamide |
|---|---|
| PubChem CID | 95902916 |
| Molecular Formula | C16H17F2N5O |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (2R)-N-(3-cyanophenyl)-2-[[1-(difluoromethyl)imidazol-2-yl]methyl-methylamino]propanamide |
| SMILES | C[C@H](C(=O)Nc1cccc(C#N)c1)N(C)Cc1nccn1C(F)F |
| InChI | InChI=1S/C16H17F2N5O/c1-11(15(24)21-13-5-3-4-12(8-13)9-19)22(2)10-14-20-6-7-23(14)16(17)18/h3-8,11,16H,10H2,1-2H3,(H,21,24)/t11-/m1/s1 |
| InChIKey | HNOPDCOVVQXHEZ-LLVKDONJSA-N |
| XLogP | 2.61 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |