C12H23N3 — CID 95905150
(3S,5S)-N',3,5-trimethyl-N-prop-2-enylpiperidine-1-carboximidamide (PubChem CID 95905150) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (3S,5S)-N',3,5-trimethyl-N-prop-2-enylpiperidine-1-carboximidamide.
| Compound Name | (3S,5S)-N',3,5-trimethyl-N-prop-2-enylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 95905150 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (3S,5S)-N',3,5-trimethyl-N-prop-2-enylpiperidine-1-carboximidamide |
| SMILES | C=CCN/C(=N\C)N1C[C@@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C12H23N3/c1-5-6-14-12(13-4)15-8-10(2)7-11(3)9-15/h5,10-11H,1,6-9H2,2-4H3,(H,13,14)/t10-,11-/m0/s1 |
| InChIKey | VKJBAAIEDLQGMB-QWRGUYRKSA-N |
| XLogP | 1.73 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|