C19H21N3O — CID 95906210
(1R)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]cyclohex-3-ene-1-carboxamide (PubChem CID 95906210) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (1R)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95906210 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (1R)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]cyclohex-3-ene-1-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1CC=CCC1)c1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-14(22-19(23)17-5-3-2-4-6-17)15-7-9-16(10-8-15)18-11-20-13-21-12-18/h2-3,7-14,17H,4-6H2,1H3,(H,22,23)/t14-,17-/m0/s1 |
| InChIKey | QKFUZQVRMYNEJU-YOEHRIQHSA-N |
| XLogP | 3.68 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|