C20H21N3O — CID 98346460
(1R,2S,4S)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 98346460) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is (1R,2S,4S)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2S,4S)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 98346460 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | (1R,2S,4S)-N-[(1S)-1-(4-pyrimidin-5-ylphenyl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | C[C@H](NC(=O)[C@H]1C[C@H]2C=C[C@H]1C2)c1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C20H21N3O/c1-13(23-20(24)19-9-14-2-3-17(19)8-14)15-4-6-16(7-5-15)18-10-21-12-22-11-18/h2-7,10-14,17,19H,8-9H2,1H3,(H,23,24)/t13-,14-,17-,19-/m0/s1 |
| InChIKey | NGYSJHGMRMSAFA-IPQUUHLSSA-N |
| XLogP | 3.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|