C18H18ClNO2 — CID 51592300
(1R,2R,4R)-N-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 51592300) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is (1R,2R,4R)-N-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | (1R,2R,4R)-N-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 51592300 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (1R,2R,4R)-N-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]bicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | C[C@H](NC(=O)[C@@H]1C[C@@H]2C=C[C@H]1C2)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C18H18ClNO2/c1-10(17-9-13-8-14(19)4-5-16(13)22-17)20-18(21)15-7-11-2-3-12(15)6-11/h2-5,8-12,15H,6-7H2,1H3,(H,20,21)/t10-,11+,12-,15+/m0/s1 |
| InChIKey | WXDMFCVWVQVTDT-OZTPJHRESA-N |
| XLogP | 4.48 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|