C16H21ClN2O3 — CID 97223768
3-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]-1-(2-hydroxy-2-methylpropyl)-1-methylurea (PubChem CID 97223768) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is 3-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]-1-(2-hydroxy-2-methylpropyl)-1-methylurea.
| Compound Name | 3-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]-1-(2-hydroxy-2-methylpropyl)-1-methylurea |
|---|---|
| PubChem CID | 97223768 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-[(1S)-1-(5-chloro-1-benzofuran-2-yl)ethyl]-1-(2-hydroxy-2-methylpropyl)-1-methylurea |
| SMILES | C[C@H](NC(=O)N(C)CC(C)(C)O)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-10(18-15(20)19(4)9-16(2,3)21)14-8-11-7-12(17)5-6-13(11)22-14/h5-8,10,21H,9H2,1-4H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | XNKGMINVRHUEKU-JTQLQIEISA-N |
| XLogP | 3.56 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |