C16H19ClN2O3 — CID 86803113
N'-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-N-methylpentanediamide (PubChem CID 86803113) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is N'-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-N-methylpentanediamide.
| Compound Name | N'-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-N-methylpentanediamide |
|---|---|
| PubChem CID | 86803113 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N'-[1-(5-chloro-1-benzofuran-2-yl)ethyl]-N-methylpentanediamide |
| SMILES | CNC(=O)CCCC(=O)NC(C)c1cc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H19ClN2O3/c1-10(19-16(21)5-3-4-15(20)18-2)14-9-11-8-12(17)6-7-13(11)22-14/h6-10H,3-5H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | AIBHIWGNJYSQIV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |