C8H11N3O2 — CID 95910172
N,N,2-trimethyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 95910172) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is N,N,2-trimethyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N,N,2-trimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 95910172 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N,N,2-trimethyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)N(C)C)c(=O)[nH]1 |
| InChI | InChI=1S/C8H11N3O2/c1-5-9-4-6(7(12)10-5)8(13)11(2)3/h4H,1-3H3,(H,9,10,12) |
| InChIKey | KGVZFNJTOCNAOO-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |