About 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile
2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile (PubChem CID 95911598) has the molecular formula C8H5N3O2
and a molecular weight of 175.15 g/mol. Its IUPAC name is 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile.
Analyze 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile?
The IUPAC name of 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile (CID 95911598) is 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile.
What is the SMILES notation for 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile?
The canonical SMILES for 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile is N#CCc1noc(-c2ccoc2)n1.
What is the InChIKey of 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile?
The InChIKey is CCMMQWPPGCAASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2/c9-3-1-7-10-8(13-11-7)6-2-4-12-5-6/h2,4-5H,1H2.
What are the key properties of 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile?
2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile has a molecular weight of 175.15 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(furan-3-yl)-1,2,4-oxadiazol-3-yl]acetonitrile is sourced from PubChem (CID 95911598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).