C15H17N3O4S — CID 95916335
2-[3-(benzenesulfonyl)-4,6-dimethyl-2-oxo-1-pyridinyl]acetohydrazide (PubChem CID 95916335) has the molecular formula C15H17N3O4S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)-4,6-dimethyl-2-oxo-1-pyridinyl]acetohydrazide.
| Compound Name | 2-[3-(benzenesulfonyl)-4,6-dimethyl-2-oxo-1-pyridinyl]acetohydrazide |
|---|---|
| PubChem CID | 95916335 |
| Molecular Formula | C15H17N3O4S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[3-(benzenesulfonyl)-4,6-dimethyl-2-oxo-1-pyridinyl]acetohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NN)c(=O)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17N3O4S/c1-10-8-11(2)18(9-13(19)17-16)15(20)14(10)23(21,22)12-6-4-3-5-7-12/h3-8H,9,16H2,1-2H3,(H,17,19) |
| InChIKey | DVQQZBMMOMBGIW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 111.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|