C24H23ClN6O2 — CID 95919932
2-[2-(4-chlorophenyl)-2-oxoethyl]-8-[4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one (PubChem CID 95919932) has the molecular formula C24H23ClN6O2 and a molecular weight of 462.94 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-oxoethyl]-8-[4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one.
| Compound Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]-8-[4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
|---|---|
| PubChem CID | 95919932 |
| Molecular Formula | C24H23ClN6O2 |
| Molecular Weight | 462.94 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-oxoethyl]-8-[4-(4-methylphenyl)piperazin-1-yl]-[1,2,4]triazolo[4,3-a]pyrazin-3-one |
| SMILES | Cc1ccc(N2CCN(c3nccn4c(=O)n(CC(=O)c5ccc(Cl)cc5)nc34)CC2)cc1 |
| InChI | InChI=1S/C24H23ClN6O2/c1-17-2-8-20(9-3-17)28-12-14-29(15-13-28)22-23-27-31(24(33)30(23)11-10-26-22)16-21(32)18-4-6-19(25)7-5-18/h2-11H,12-16H2,1H3 |
| InChIKey | FMPPNKGTTJARJJ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.94 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|