C24H19FN4O6S — CID 95921477
4-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-fluorophenyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 95921477) has the molecular formula C24H19FN4O6S and a molecular weight of 510.50 g/mol. Its IUPAC name is 4-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-fluorophenyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 4-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-fluorophenyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 95921477 |
| Molecular Formula | C24H19FN4O6S |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 4-[[3-(2,3-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-(4-fluorophenyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | COc1cccc(-c2noc(CN3C(=O)N(c4ccc(F)cc4)S(=O)(=O)c4ccccc43)n2)c1OC |
| InChI | InChI=1S/C24H19FN4O6S/c1-33-19-8-5-6-17(22(19)34-2)23-26-21(35-27-23)14-28-18-7-3-4-9-20(18)36(31,32)29(24(28)30)16-12-10-15(25)11-13-16/h3-13H,14H2,1-2H3 |
| InChIKey | HFMUIOMYWDGDFM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 115.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |