C18H17N3O3S — CID 95926883
2-[6-(3-methylphenyl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]oxyacetic acid (PubChem CID 95926883) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[6-(3-methylphenyl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]oxyacetic acid.
| Compound Name | 2-[6-(3-methylphenyl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 95926883 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[6-(3-methylphenyl)-2-(thiophen-2-ylmethylamino)pyrimidin-4-yl]oxyacetic acid |
| SMILES | Cc1cccc(-c2cc(OCC(=O)O)nc(NCc3cccs3)n2)c1 |
| InChI | InChI=1S/C18H17N3O3S/c1-12-4-2-5-13(8-12)15-9-16(24-11-17(22)23)21-18(20-15)19-10-14-6-3-7-25-14/h2-9H,10-11H2,1H3,(H,22,23)(H,19,20,21) |
| InChIKey | OBQRWJLZEOSXAI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |