C18H29N3O2 — CID 95930381
(3aR,7aR)-N-[2-(cyclohexanecarbonylamino)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide (PubChem CID 95930381) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (3aR,7aR)-N-[2-(cyclohexanecarbonylamino)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide.
| Compound Name | (3aR,7aR)-N-[2-(cyclohexanecarbonylamino)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 95930381 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (3aR,7aR)-N-[2-(cyclohexanecarbonylamino)ethyl]-1,3,3a,4,7,7a-hexahydroisoindole-2-carboxamide |
| SMILES | O=C(NCCNC(=O)N1C[C@@H]2CC=CC[C@H]2C1)C1CCCCC1 |
| InChI | InChI=1S/C18H29N3O2/c22-17(14-6-2-1-3-7-14)19-10-11-20-18(23)21-12-15-8-4-5-9-16(15)13-21/h4-5,14-16H,1-3,6-13H2,(H,19,22)(H,20,23)/t15-,16-/m0/s1 |
| InChIKey | VBLYAFRJBNTQHX-HOTGVXAUSA-N |
| XLogP | 2.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|