C19H29FN4O — CID 95934076
N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-4-(2-fluoroanilino)piperidine-1-carboxamide (PubChem CID 95934076) has the molecular formula C19H29FN4O and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-4-(2-fluoroanilino)piperidine-1-carboxamide.
| Compound Name | N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-4-(2-fluoroanilino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95934076 |
| Molecular Formula | C19H29FN4O |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | N-[(2R)-2-[cyclopropyl(methyl)amino]propyl]-4-(2-fluoroanilino)piperidine-1-carboxamide |
| SMILES | C[C@H](CNC(=O)N1CCC(Nc2ccccc2F)CC1)N(C)C1CC1 |
| InChI | InChI=1S/C19H29FN4O/c1-14(23(2)16-7-8-16)13-21-19(25)24-11-9-15(10-12-24)22-18-6-4-3-5-17(18)20/h3-6,14-16,22H,7-13H2,1-2H3,(H,21,25)/t14-/m1/s1 |
| InChIKey | AAQOYUGBKPHUAM-CQSZACIVSA-N |
| XLogP | 2.89 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |