C17H22ClN3O — CID 95934995
2-[[(1R)-1-(4-chlorophenyl)ethyl]-methylamino]-N-(1-cyanocyclopentyl)acetamide (PubChem CID 95934995) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 2-[[(1R)-1-(4-chlorophenyl)ethyl]-methylamino]-N-(1-cyanocyclopentyl)acetamide.
| Compound Name | 2-[[(1R)-1-(4-chlorophenyl)ethyl]-methylamino]-N-(1-cyanocyclopentyl)acetamide |
|---|---|
| PubChem CID | 95934995 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-[[(1R)-1-(4-chlorophenyl)ethyl]-methylamino]-N-(1-cyanocyclopentyl)acetamide |
| SMILES | C[C@H](c1ccc(Cl)cc1)N(C)CC(=O)NC1(C#N)CCCC1 |
| InChI | InChI=1S/C17H22ClN3O/c1-13(14-5-7-15(18)8-6-14)21(2)11-16(22)20-17(12-19)9-3-4-10-17/h5-8,13H,3-4,9-11H2,1-2H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | NKKCPGAZOIWVAG-CYBMUJFWSA-N |
| XLogP | 3.29 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |