C18H20FN3O2 — CID 95961521
1-cyclopropyl-3-[(1S)-1-(3-fluoro-4-pyridin-3-yloxyphenyl)ethyl]-1-methylurea (PubChem CID 95961521) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1S)-1-(3-fluoro-4-pyridin-3-yloxyphenyl)ethyl]-1-methylurea.
| Compound Name | 1-cyclopropyl-3-[(1S)-1-(3-fluoro-4-pyridin-3-yloxyphenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 95961521 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-cyclopropyl-3-[(1S)-1-(3-fluoro-4-pyridin-3-yloxyphenyl)ethyl]-1-methylurea |
| SMILES | C[C@H](NC(=O)N(C)C1CC1)c1ccc(Oc2cccnc2)c(F)c1 |
| InChI | InChI=1S/C18H20FN3O2/c1-12(21-18(23)22(2)14-6-7-14)13-5-8-17(16(19)10-13)24-15-4-3-9-20-11-15/h3-5,8-12,14H,6-7H2,1-2H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | XFFGYKPKZAUDJU-LBPRGKRZSA-N |
| XLogP | 3.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |