C10H16F3NO — CID 95970471
(2S,6R)-2-cyclopentyl-6-(trifluoromethyl)morpholine (PubChem CID 95970471) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is (2S,6R)-2-cyclopentyl-6-(trifluoromethyl)morpholine.
| Compound Name | (2S,6R)-2-cyclopentyl-6-(trifluoromethyl)morpholine |
|---|---|
| PubChem CID | 95970471 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (2S,6R)-2-cyclopentyl-6-(trifluoromethyl)morpholine |
| SMILES | FC(F)(F)[C@H]1CNC[C@H](C2CCCC2)O1 |
| InChI | InChI=1S/C10H16F3NO/c11-10(12,13)9-6-14-5-8(15-9)7-3-1-2-4-7/h7-9,14H,1-6H2/t8-,9-/m1/s1 |
| InChIKey | PQRFYIAFENWTLV-RKDXNWHRSA-N |
| XLogP | 2.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |