About (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide
(2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide (PubChem CID 95972706) has the molecular formula C19H20ClNO3
and a molecular weight of 345.83 g/mol. Its IUPAC name is (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide |
| PubChem CID | 95972706 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide |
| SMILES | C[C@@H](c1ccc(Cl)cc1)N(C(=O)[C@H]1COCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H20ClNO3/c1-14(15-7-9-16(20)10-8-15)21(17-5-3-2-4-6-17)19(22)18-13-23-11-12-24-18/h2-10,14,18H,11-13H2,1H3/t14-,18+/m0/s1 |
| InChIKey | PMJKGYPAOOSFLW-KBXCAEBGSA-N |
| XLogP | 3.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide?
The IUPAC name of (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide (CID 95972706) is (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide.
What is the SMILES notation for (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide?
The canonical SMILES for (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide is C[C@@H](c1ccc(Cl)cc1)N(C(=O)[C@H]1COCCO1)c1ccccc1.
What is the InChIKey of (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide?
The InChIKey is PMJKGYPAOOSFLW-KBXCAEBGSA-N. The full InChI is InChI=1S/C19H20ClNO3/c1-14(15-7-9-16(20)10-8-15)21(17-5-3-2-4-6-17)19(22)18-13-23-11-12-24-18/h2-10,14,18H,11-13H2,1H3/t14-,18+/m0/s1.
What are the key properties of (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide?
(2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide has a molecular weight of 345.83 g/mol, XLogP of 3.85, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-[(1S)-1-(4-chlorophenyl)ethyl]-N-phenyl-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 95972706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).