C12H16BrN3O3 — CID 95974856
1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-[[(2R)-oxolan-2-yl]methyl]urea (PubChem CID 95974856) has the molecular formula C12H16BrN3O3 and a molecular weight of 330.18 g/mol. Its IUPAC name is 1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-[[(2R)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-[[(2R)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95974856 |
| Molecular Formula | C12H16BrN3O3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | 1-(5-bromo-1-methyl-2-oxo-3-pyridinyl)-3-[[(2R)-oxolan-2-yl]methyl]urea |
| SMILES | Cn1cc(Br)cc(NC(=O)NC[C@H]2CCCO2)c1=O |
| InChI | InChI=1S/C12H16BrN3O3/c1-16-7-8(13)5-10(11(16)17)15-12(18)14-6-9-3-2-4-19-9/h5,7,9H,2-4,6H2,1H3,(H2,14,15,18)/t9-/m1/s1 |
| InChIKey | HTPPGLBGWVPZIT-SECBINFHSA-N |
| XLogP | 1.45 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |