C19H31NO2 — CID 95975809
3-[(2R)-4-methylpentan-2-yl]oxy-N-(2-methyl-2-phenylpropyl)propanamide (PubChem CID 95975809) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3-[(2R)-4-methylpentan-2-yl]oxy-N-(2-methyl-2-phenylpropyl)propanamide.
| Compound Name | 3-[(2R)-4-methylpentan-2-yl]oxy-N-(2-methyl-2-phenylpropyl)propanamide |
|---|---|
| PubChem CID | 95975809 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 3-[(2R)-4-methylpentan-2-yl]oxy-N-(2-methyl-2-phenylpropyl)propanamide |
| SMILES | CC(C)C[C@@H](C)OCCC(=O)NCC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H31NO2/c1-15(2)13-16(3)22-12-11-18(21)20-14-19(4,5)17-9-7-6-8-10-17/h6-10,15-16H,11-14H2,1-5H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | GJTJIKOJFQTYOT-MRXNPFEDSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |