C20H34N2O2 — CID 95978212
(1R)-2-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-1-(4-propan-2-ylphenyl)ethanol (PubChem CID 95978212) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is (1R)-2-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-1-(4-propan-2-ylphenyl)ethanol.
| Compound Name | (1R)-2-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-1-(4-propan-2-ylphenyl)ethanol |
|---|---|
| PubChem CID | 95978212 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | (1R)-2-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-1-(4-propan-2-ylphenyl)ethanol |
| SMILES | CCOCCN1CCN(C[C@H](O)c2ccc(C(C)C)cc2)C[C@@H]1C |
| InChI | InChI=1S/C20H34N2O2/c1-5-24-13-12-22-11-10-21(14-17(22)4)15-20(23)19-8-6-18(7-9-19)16(2)3/h6-9,16-17,20,23H,5,10-15H2,1-4H3/t17-,20-/m0/s1 |
| InChIKey | ULDMMZMJYPDHNN-PXNSSMCTSA-N |
| XLogP | 2.89 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|