C18H37N3O2 — CID 100842222
(2S)-1-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 100842222) has the molecular formula C18H37N3O2 and a molecular weight of 327.51 g/mol. Its IUPAC name is (2S)-1-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 100842222 |
| Molecular Formula | C18H37N3O2 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.29 |
| IUPAC Name | (2S)-1-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | CCOCCN1CCN(C[C@@H](O)CN2CCC(C)CC2)C[C@@H]1C |
| InChI | InChI=1S/C18H37N3O2/c1-4-23-12-11-21-10-9-20(13-17(21)3)15-18(22)14-19-7-5-16(2)6-8-19/h16-18,22H,4-15H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | AKKNGPIBEYLNCI-ROUUACIJSA-N |
| XLogP | 1.12 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|