C14H31N3O3S — CID 95347534
3-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N,N-dimethylpropane-1-sulfonamide (PubChem CID 95347534) has the molecular formula C14H31N3O3S and a molecular weight of 321.49 g/mol. Its IUPAC name is 3-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N,N-dimethylpropane-1-sulfonamide.
| Compound Name | 3-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N,N-dimethylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 95347534 |
| Molecular Formula | C14H31N3O3S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-[(3S)-4-(2-ethoxyethyl)-3-methylpiperazin-1-yl]-N,N-dimethylpropane-1-sulfonamide |
| SMILES | CCOCCN1CCN(CCCS(=O)(=O)N(C)C)C[C@@H]1C |
| InChI | InChI=1S/C14H31N3O3S/c1-5-20-11-10-17-9-8-16(13-14(17)2)7-6-12-21(18,19)15(3)4/h14H,5-13H2,1-4H3/t14-/m0/s1 |
| InChIKey | QQFJLWGKNKUBNW-AWEZNQCLSA-N |
| XLogP | 0.31 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|