C13H28N2O3S — CID 95317636
(2S)-1-(2-ethoxyethyl)-2-ethyl-4-(2-methylsulfonylethyl)piperazine (PubChem CID 95317636) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is (2S)-1-(2-ethoxyethyl)-2-ethyl-4-(2-methylsulfonylethyl)piperazine.
| Compound Name | (2S)-1-(2-ethoxyethyl)-2-ethyl-4-(2-methylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 95317636 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2S)-1-(2-ethoxyethyl)-2-ethyl-4-(2-methylsulfonylethyl)piperazine |
| SMILES | CCOCCN1CCN(CCS(C)(=O)=O)C[C@@H]1CC |
| InChI | InChI=1S/C13H28N2O3S/c1-4-13-12-14(9-11-19(3,16)17)6-7-15(13)8-10-18-5-2/h13H,4-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | XWKNRXILHDLIBU-ZDUSSCGKSA-N |
| XLogP | 0.46 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|