C12H15F3N2O3 — CID 95980213
1-(3-methoxyphenyl)-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea (PubChem CID 95980213) has the molecular formula C12H15F3N2O3 and a molecular weight of 292.26 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea.
| Compound Name | 1-(3-methoxyphenyl)-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea |
|---|---|
| PubChem CID | 95980213 |
| Molecular Formula | C12H15F3N2O3 |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[(3R)-4,4,4-trifluoro-3-hydroxybutyl]urea |
| SMILES | COc1cccc(NC(=O)NCC[C@@H](O)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O3/c1-20-9-4-2-3-8(7-9)17-11(19)16-6-5-10(18)12(13,14)15/h2-4,7,10,18H,5-6H2,1H3,(H2,16,17,19)/t10-/m1/s1 |
| InChIKey | IMFWSFQGCRFAER-SNVBAGLBSA-N |
| XLogP | 2.13 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |